C28H26N2O9 — CID 3279229
[4-[2-[5-(4-ethoxyanilino)-5-oxopentanoyl]oxyacetyl]phenyl] 4-nitrobenzoate (PubChem CID 3279229) has the molecular formula C28H26N2O9 and a molecular weight of 534.52 g/mol. Its IUPAC name is [4-[2-[5-(4-ethoxyanilino)-5-oxopentanoyl]oxyacetyl]phenyl] 4-nitrobenzoate.
| Compound Name | [4-[2-[5-(4-ethoxyanilino)-5-oxopentanoyl]oxyacetyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 3279229 |
| Molecular Formula | C28H26N2O9 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | [4-[2-[5-(4-ethoxyanilino)-5-oxopentanoyl]oxyacetyl]phenyl] 4-nitrobenzoate |
| SMILES | CCOc1ccc(NC(=O)CCCC(=O)OCC(=O)c2ccc(OC(=O)c3ccc([N+](=O)[O-])cc3)cc2)cc1 |
| InChI | InChI=1S/C28H26N2O9/c1-2-37-23-16-10-21(11-17-23)29-26(32)4-3-5-27(33)38-18-25(31)19-8-14-24(15-9-19)39-28(34)20-6-12-22(13-7-20)30(35)36/h6-17H,2-5,18H2,1H3,(H,29,32) |
| InChIKey | UDYJYXCYVXOEQO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 151.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|