C20H22N4O5 — CID 6067598
N-(4-ethoxyphenyl)-N'-[(Z)-1-(4-nitrophenyl)ethylideneamino]butanediamide (PubChem CID 6067598) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-N'-[(Z)-1-(4-nitrophenyl)ethylideneamino]butanediamide.
| Compound Name | N-(4-ethoxyphenyl)-N'-[(Z)-1-(4-nitrophenyl)ethylideneamino]butanediamide |
|---|---|
| PubChem CID | 6067598 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-(4-ethoxyphenyl)-N'-[(Z)-1-(4-nitrophenyl)ethylideneamino]butanediamide |
| SMILES | CCOc1ccc(NC(=O)CCC(=O)N/N=C(/C)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C20H22N4O5/c1-3-29-18-10-6-16(7-11-18)21-19(25)12-13-20(26)23-22-14(2)15-4-8-17(9-5-15)24(27)28/h4-11H,3,12-13H2,1-2H3,(H,21,25)(H,23,26)/b22-14- |
| InChIKey | KSVLLAVAEXXICI-HMAPJEAMSA-N |
| XLogP | 3.25 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|