C19H19N4O6- — CID 7311322
2-[(Z)-[[4-(4-ethoxyanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-4-nitrophenolate (PubChem CID 7311322) has the molecular formula C19H19N4O6- and a molecular weight of 399.38 g/mol. Its IUPAC name is 2-[(Z)-[[4-(4-ethoxyanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-[(Z)-[[4-(4-ethoxyanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 7311322 |
| Molecular Formula | C19H19N4O6- |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-[(Z)-[[4-(4-ethoxyanilino)-4-oxobutanoyl]hydrazinylidene]methyl]-4-nitrophenolate |
| SMILES | CCOc1ccc(NC(=O)CCC(=O)N/N=C\c2cc([N+](=O)[O-])ccc2[O-])cc1 |
| InChI | InChI=1S/C19H20N4O6/c1-2-29-16-6-3-14(4-7-16)21-18(25)9-10-19(26)22-20-12-13-11-15(23(27)28)5-8-17(13)24/h3-8,11-12,24H,2,9-10H2,1H3,(H,21,25)(H,22,26)/p-1/b20-12- |
| InChIKey | VDBVQXKQVWYYAL-NDENLUEZSA-M |
| XLogP | 1.94 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|