C18H18N3O5- — CID 6998834
4-nitro-2-[[[2-(4-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenolate (PubChem CID 6998834) has the molecular formula C18H18N3O5- and a molecular weight of 356.36 g/mol. Its IUPAC name is 4-nitro-2-[[[2-(4-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenolate.
| Compound Name | 4-nitro-2-[[[2-(4-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenolate |
|---|---|
| PubChem CID | 6998834 |
| Molecular Formula | C18H18N3O5- |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 4-nitro-2-[[[2-(4-propan-2-ylphenoxy)acetyl]hydrazinylidene]methyl]phenolate |
| SMILES | CC(C)c1ccc(OCC(=O)NN=Cc2cc([N+](=O)[O-])ccc2[O-])cc1 |
| InChI | InChI=1S/C18H19N3O5/c1-12(2)13-3-6-16(7-4-13)26-11-18(23)20-19-10-14-9-15(21(24)25)5-8-17(14)22/h3-10,12,22H,11H2,1-2H3,(H,20,23)/p-1 |
| InChIKey | HOLOSLXKEXNRKZ-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|