C16H12Br2N3O6- — CID 6109313
2-[(Z)-[[2-(2,4-dibromo-6-methoxyphenoxy)acetyl]hydrazinylidene]methyl]-4-nitrophenolate (PubChem CID 6109313) has the molecular formula C16H12Br2N3O6- and a molecular weight of 502.10 g/mol. Its IUPAC name is 2-[(Z)-[[2-(2,4-dibromo-6-methoxyphenoxy)acetyl]hydrazinylidene]methyl]-4-nitrophenolate.
| Compound Name | 2-[(Z)-[[2-(2,4-dibromo-6-methoxyphenoxy)acetyl]hydrazinylidene]methyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 6109313 |
| Molecular Formula | C16H12Br2N3O6- |
| Molecular Weight | 502.10 g/mol |
| Exact Mass | 499.91 |
| IUPAC Name | 2-[(Z)-[[2-(2,4-dibromo-6-methoxyphenoxy)acetyl]hydrazinylidene]methyl]-4-nitrophenolate |
| SMILES | COc1cc(Br)cc(Br)c1OCC(=O)N/N=C\c1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C16H13Br2N3O6/c1-26-14-6-10(17)5-12(18)16(14)27-8-15(23)20-19-7-9-4-11(21(24)25)2-3-13(9)22/h2-7,22H,8H2,1H3,(H,20,23)/p-1/b19-7- |
| InChIKey | NEMBSITYMSRGKC-GXHLCREISA-M |
| XLogP | 2.73 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.10 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|