C15H10Br2N4O7 — CID 135643548
N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(2-bromo-4-nitrophenoxy)acetamide (PubChem CID 135643548) has the molecular formula C15H10Br2N4O7 and a molecular weight of 518.07 g/mol. Its IUPAC name is N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(2-bromo-4-nitrophenoxy)acetamide.
| Compound Name | N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(2-bromo-4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 135643548 |
| Molecular Formula | C15H10Br2N4O7 |
| Molecular Weight | 518.07 g/mol |
| Exact Mass | 515.89 |
| IUPAC Name | N-[(E)-(3-bromo-2-hydroxy-5-nitrophenyl)methylideneamino]-2-(2-bromo-4-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1Br)N/N=C/c1cc([N+](=O)[O-])cc(Br)c1O |
| InChI | InChI=1S/C15H10Br2N4O7/c16-11-4-9(20(24)25)1-2-13(11)28-7-14(22)19-18-6-8-3-10(21(26)27)5-12(17)15(8)23/h1-6,23H,7H2,(H,19,22)/b18-6+ |
| InChIKey | STTMFEOSPWXZNC-NGYBGAFCSA-N |
| XLogP | 3.26 |
| TPSA | 157.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.07 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|