C15H10Br3N3O6 — CID 3714973
2-(2-bromo-4-nitrophenoxy)-N-[(2,5-dibromo-3,4-dihydroxyphenyl)methylideneamino]acetamide (PubChem CID 3714973) has the molecular formula C15H10Br3N3O6 and a molecular weight of 567.97 g/mol. Its IUPAC name is 2-(2-bromo-4-nitrophenoxy)-N-[(2,5-dibromo-3,4-dihydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2-bromo-4-nitrophenoxy)-N-[(2,5-dibromo-3,4-dihydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 3714973 |
| Molecular Formula | C15H10Br3N3O6 |
| Molecular Weight | 567.97 g/mol |
| Exact Mass | 564.81 |
| IUPAC Name | 2-(2-bromo-4-nitrophenoxy)-N-[(2,5-dibromo-3,4-dihydroxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1Br)NN=Cc1cc(Br)c(O)c(O)c1Br |
| InChI | InChI=1S/C15H10Br3N3O6/c16-9-4-8(21(25)26)1-2-11(9)27-6-12(22)20-19-5-7-3-10(17)14(23)15(24)13(7)18/h1-5,23-24H,6H2,(H,20,22) |
| InChIKey | WRIIVPYKOSLYGO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 134.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.97 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|