C17H16BrN3O6 — CID 5089183
N-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-(4-nitrophenoxy)acetamide (PubChem CID 5089183) has the molecular formula C17H16BrN3O6 and a molecular weight of 438.23 g/mol. Its IUPAC name is N-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 5089183 |
| Molecular Formula | C17H16BrN3O6 |
| Molecular Weight | 438.23 g/mol |
| Exact Mass | 437.02 |
| IUPAC Name | N-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-2-(4-nitrophenoxy)acetamide |
| SMILES | COc1cc(OC)c(C=NNC(=O)COc2ccc([N+](=O)[O-])cc2)cc1Br |
| InChI | InChI=1S/C17H16BrN3O6/c1-25-15-8-16(26-2)14(18)7-11(15)9-19-20-17(22)10-27-13-5-3-12(4-6-13)21(23)24/h3-9H,10H2,1-2H3,(H,20,22) |
| InChIKey | NOAWPJOSLOQIFN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 112.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|