C16H12Br2N4O9 — CID 136720690
N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2-(2-methoxy-4,6-dinitrophenoxy)acetamide (PubChem CID 136720690) has the molecular formula C16H12Br2N4O9 and a molecular weight of 564.10 g/mol. Its IUPAC name is N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2-(2-methoxy-4,6-dinitrophenoxy)acetamide.
| Compound Name | N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2-(2-methoxy-4,6-dinitrophenoxy)acetamide |
|---|---|
| PubChem CID | 136720690 |
| Molecular Formula | C16H12Br2N4O9 |
| Molecular Weight | 564.10 g/mol |
| Exact Mass | 561.90 |
| IUPAC Name | N-[(Z)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]-2-(2-methoxy-4,6-dinitrophenoxy)acetamide |
| SMILES | COc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OCC(=O)N/N=C\c1cc(Br)c(O)c(Br)c1O |
| InChI | InChI=1S/C16H12Br2N4O9/c1-30-11-4-8(21(26)27)3-10(22(28)29)16(11)31-6-12(23)20-19-5-7-2-9(17)15(25)13(18)14(7)24/h2-5,24-25H,6H2,1H3,(H,20,23)/b19-5- |
| InChIKey | MPOPXOCKCAHENS-IPKBDRFQSA-N |
| XLogP | 2.98 |
| TPSA | 186.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.10 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|