C23H29ClN4O4 — CID 6036793
N-[(Z)-[2-[bis(2-methylpropyl)amino]-5-nitrophenyl]methylideneamino]-2-(4-chlorophenoxy)acetamide (PubChem CID 6036793) has the molecular formula C23H29ClN4O4 and a molecular weight of 460.96 g/mol. Its IUPAC name is N-[(Z)-[2-[bis(2-methylpropyl)amino]-5-nitrophenyl]methylideneamino]-2-(4-chlorophenoxy)acetamide.
| Compound Name | N-[(Z)-[2-[bis(2-methylpropyl)amino]-5-nitrophenyl]methylideneamino]-2-(4-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 6036793 |
| Molecular Formula | C23H29ClN4O4 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | N-[(Z)-[2-[bis(2-methylpropyl)amino]-5-nitrophenyl]methylideneamino]-2-(4-chlorophenoxy)acetamide |
| SMILES | CC(C)CN(CC(C)C)c1ccc([N+](=O)[O-])cc1/C=N\NC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H29ClN4O4/c1-16(2)13-27(14-17(3)4)22-10-7-20(28(30)31)11-18(22)12-25-26-23(29)15-32-21-8-5-19(24)6-9-21/h5-12,16-17H,13-15H2,1-4H3,(H,26,29)/b25-12- |
| InChIKey | QXHLSHIBJSRUGP-ROTLSHHCSA-N |
| XLogP | 4.90 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|