C23H29BrN4O4 — CID 4234942
N-[[2-[bis(2-methylpropyl)amino]-5-nitrophenyl]methylideneamino]-2-(2-bromophenoxy)acetamide (PubChem CID 4234942) has the molecular formula C23H29BrN4O4 and a molecular weight of 505.41 g/mol. Its IUPAC name is N-[[2-[bis(2-methylpropyl)amino]-5-nitrophenyl]methylideneamino]-2-(2-bromophenoxy)acetamide.
| Compound Name | N-[[2-[bis(2-methylpropyl)amino]-5-nitrophenyl]methylideneamino]-2-(2-bromophenoxy)acetamide |
|---|---|
| PubChem CID | 4234942 |
| Molecular Formula | C23H29BrN4O4 |
| Molecular Weight | 505.41 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N-[[2-[bis(2-methylpropyl)amino]-5-nitrophenyl]methylideneamino]-2-(2-bromophenoxy)acetamide |
| SMILES | CC(C)CN(CC(C)C)c1ccc([N+](=O)[O-])cc1C=NNC(=O)COc1ccccc1Br |
| InChI | InChI=1S/C23H29BrN4O4/c1-16(2)13-27(14-17(3)4)21-10-9-19(28(30)31)11-18(21)12-25-26-23(29)15-32-22-8-6-5-7-20(22)24/h5-12,16-17H,13-15H2,1-4H3,(H,26,29) |
| InChIKey | ICGXOPCETWVMKE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|