C25H35N5O3 — CID 5012211
N-[[2-[bis(2-methylpropyl)amino]-5-nitrophenyl]methylideneamino]-2-(3,4-dimethylanilino)acetamide (PubChem CID 5012211) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-[[2-[bis(2-methylpropyl)amino]-5-nitrophenyl]methylideneamino]-2-(3,4-dimethylanilino)acetamide.
| Compound Name | N-[[2-[bis(2-methylpropyl)amino]-5-nitrophenyl]methylideneamino]-2-(3,4-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 5012211 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | N-[[2-[bis(2-methylpropyl)amino]-5-nitrophenyl]methylideneamino]-2-(3,4-dimethylanilino)acetamide |
| SMILES | Cc1ccc(NCC(=O)NN=Cc2cc([N+](=O)[O-])ccc2N(CC(C)C)CC(C)C)cc1C |
| InChI | InChI=1S/C25H35N5O3/c1-17(2)15-29(16-18(3)4)24-10-9-23(30(32)33)12-21(24)13-27-28-25(31)14-26-22-8-7-19(5)20(6)11-22/h7-13,17-18,26H,14-16H2,1-6H3,(H,28,31) |
| InChIKey | AYZCVIPGTYXMAP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|