C20H21N7O3S — CID 126197184
2-(3,4-dimethylanilino)-N-[(Z)-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]acetamide (PubChem CID 126197184) has the molecular formula C20H21N7O3S and a molecular weight of 439.50 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)-N-[(Z)-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]acetamide.
| Compound Name | 2-(3,4-dimethylanilino)-N-[(Z)-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126197184 |
| Molecular Formula | C20H21N7O3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-(3,4-dimethylanilino)-N-[(Z)-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]methylideneamino]acetamide |
| SMILES | Cc1nc(Sc2ccc(/C=N\NC(=O)CNc3ccc(C)c(C)c3)cc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C20H21N7O3S/c1-12-4-6-16(8-13(12)2)21-11-19(28)25-22-10-15-5-7-18(17(9-15)27(29)30)31-20-23-14(3)24-26-20/h4-10,21H,11H2,1-3H3,(H,25,28)(H,23,24,26)/b22-10- |
| InChIKey | CJHFHGVWKICMSY-YVNNLAQVSA-N |
| XLogP | 3.35 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|