C16H13N7O2S2 — CID 126198756
[(Z)-[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]thiourea (PubChem CID 126198756) has the molecular formula C16H13N7O2S2 and a molecular weight of 399.46 g/mol. Its IUPAC name is [(Z)-[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]thiourea.
| Compound Name | [(Z)-[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 126198756 |
| Molecular Formula | C16H13N7O2S2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | [(Z)-[3-nitro-4-[(5-phenyl-1H-1,2,4-triazol-3-yl)sulfanyl]phenyl]methylideneamino]thiourea |
| SMILES | NC(=S)N/N=C\c1ccc(Sc2n[nH]c(-c3ccccc3)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H13N7O2S2/c17-15(26)21-18-9-10-6-7-13(12(8-10)23(24)25)27-16-19-14(20-22-16)11-4-2-1-3-5-11/h1-9H,(H3,17,21,26)(H,19,20,22)/b18-9- |
| InChIKey | YLCVAEISQKLWRG-NVMNQCDNSA-N |
| XLogP | 2.70 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|