C26H17ClF3N5O4S — CID 126126404
2-(4-chlorophenoxy)-N-[(E)-[3-nitro-4-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methylideneamino]acetamide (PubChem CID 126126404) has the molecular formula C26H17ClF3N5O4S and a molecular weight of 587.97 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[(E)-[3-nitro-4-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[(E)-[3-nitro-4-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126126404 |
| Molecular Formula | C26H17ClF3N5O4S |
| Molecular Weight | 587.97 g/mol |
| Exact Mass | 587.06 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[(E)-[3-nitro-4-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1)N/N=C/c1ccc(Sc2nc(-c3ccccc3)cc(C(F)(F)F)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H17ClF3N5O4S/c27-18-7-9-19(10-8-18)39-15-24(36)34-31-14-16-6-11-22(21(12-16)35(37)38)40-25-32-20(17-4-2-1-3-5-17)13-23(33-25)26(28,29)30/h1-14H,15H2,(H,34,36)/b31-14+ |
| InChIKey | VAUOBABWODLOTK-XAZZYMPDSA-N |
| XLogP | 6.40 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.97 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|