C34H26F3N5O3S2 — CID 126124724
N-benzyl-2-[[3-nitro-4-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126124724) has the molecular formula C34H26F3N5O3S2 and a molecular weight of 673.74 g/mol. Its IUPAC name is N-benzyl-2-[[3-nitro-4-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-benzyl-2-[[3-nitro-4-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126124724 |
| Molecular Formula | C34H26F3N5O3S2 |
| Molecular Weight | 673.74 g/mol |
| Exact Mass | 673.14 |
| IUPAC Name | N-benzyl-2-[[3-nitro-4-[4-phenyl-6-(trifluoromethyl)pyrimidin-2-yl]sulfanylphenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1c(N=Cc2ccc(Sc3nc(-c4ccccc4)cc(C(F)(F)F)n3)c([N+](=O)[O-])c2)sc2c1CCCC2 |
| InChI | InChI=1S/C34H26F3N5O3S2/c35-34(36,37)29-18-25(23-11-5-2-6-12-23)40-33(41-29)47-28-16-15-22(17-26(28)42(44)45)20-39-32-30(24-13-7-8-14-27(24)46-32)31(43)38-19-21-9-3-1-4-10-21/h1-6,9-12,15-18,20H,7-8,13-14,19H2,(H,38,43) |
| InChIKey | ZLGKBCYLEWBGQF-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.74 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|