C32H32ClN5O3S2 — CID 126167939
(6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126167939) has the molecular formula C32H32ClN5O3S2 and a molecular weight of 634.23 g/mol. Its IUPAC name is (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126167939 |
| Molecular Formula | C32H32ClN5O3S2 |
| Molecular Weight | 634.23 g/mol |
| Exact Mass | 633.16 |
| IUPAC Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cc(C)nc(Sc2ccc(C=Nc3sc4c(c3C(=O)Nc3ccc(Cl)cc3)CC[C@H](C(C)(C)C)C4)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C32H32ClN5O3S2/c1-18-14-19(2)36-31(35-18)43-26-13-6-20(15-25(26)38(40)41)17-34-30-28(29(39)37-23-10-8-22(33)9-11-23)24-12-7-21(32(3,4)5)16-27(24)42-30/h6,8-11,13-15,17,21H,7,12,16H2,1-5H3,(H,37,39)/t21-/m0/s1 |
| InChIKey | OKTFJMCWIHDUAX-NRFANRHFSA-N |
| XLogP | 9.02 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.23 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|