C26H25ClIN3O4S — CID 137085601
(6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 137085601) has the molecular formula C26H25ClIN3O4S and a molecular weight of 637.93 g/mol. Its IUPAC name is (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 137085601 |
| Molecular Formula | C26H25ClIN3O4S |
| Molecular Weight | 637.93 g/mol |
| Exact Mass | 637.03 |
| IUPAC Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3cc(I)c(O)c([N+](=O)[O-])c3)c2C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H25ClIN3O4S/c1-26(2,3)15-4-9-18-21(12-15)36-25(22(18)24(33)30-17-7-5-16(27)6-8-17)29-13-14-10-19(28)23(32)20(11-14)31(34)35/h5-8,10-11,13,15,32H,4,9,12H2,1-3H3,(H,30,33)/t15-/m0/s1 |
| InChIKey | ZLCZICNEDGRGNA-HNNXBMFYSA-N |
| XLogP | 7.77 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.93 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|