C30H28ClN3O4S — CID 126085928
(6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126085928) has the molecular formula C30H28ClN3O4S and a molecular weight of 562.09 g/mol. Its IUPAC name is (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126085928 |
| Molecular Formula | C30H28ClN3O4S |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[[5-(4-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3ccc(-c4ccc([N+](=O)[O-])cc4)o3)c2C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C30H28ClN3O4S/c1-30(2,3)19-6-14-24-26(16-19)39-29(27(24)28(35)33-21-9-7-20(31)8-10-21)32-17-23-13-15-25(38-23)18-4-11-22(12-5-18)34(36)37/h4-5,7-13,15,17,19H,6,14,16H2,1-3H3,(H,33,35)/t19-/m0/s1 |
| InChIKey | KZLQLLQPJSDAGA-IBGZPJMESA-N |
| XLogP | 8.72 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|