C26H26ClN3O4S — CID 137027494
(6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(2-hydroxy-5-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 137027494) has the molecular formula C26H26ClN3O4S and a molecular weight of 512.03 g/mol. Its IUPAC name is (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(2-hydroxy-5-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(2-hydroxy-5-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 137027494 |
| Molecular Formula | C26H26ClN3O4S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(2-hydroxy-5-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3cc([N+](=O)[O-])ccc3O)c2C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H26ClN3O4S/c1-26(2,3)16-4-10-20-22(13-16)35-25(23(20)24(32)29-18-7-5-17(27)6-8-18)28-14-15-12-19(30(33)34)9-11-21(15)31/h5-9,11-12,14,16,31H,4,10,13H2,1-3H3,(H,29,32)/t16-/m0/s1 |
| InChIKey | XBHTWEZLLJXSAO-INIZCTEOSA-N |
| XLogP | 7.17 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|