C30H34N4O4S — CID 126093568
(6R)-6-tert-butyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126093568) has the molecular formula C30H34N4O4S and a molecular weight of 546.69 g/mol. Its IUPAC name is (6R)-6-tert-butyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126093568 |
| Molecular Formula | C30H34N4O4S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | (6R)-6-tert-butyl-2-[(2-morpholin-4-yl-5-nitrophenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(N=Cc3cc([N+](=O)[O-])ccc3N3CCOCC3)c2C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C30H34N4O4S/c1-30(2,3)21-9-11-24-26(18-21)39-29(27(24)28(35)32-22-7-5-4-6-8-22)31-19-20-17-23(34(36)37)10-12-25(20)33-13-15-38-16-14-33/h4-8,10,12,17,19,21H,9,11,13-16,18H2,1-3H3,(H,32,35)/t21-/m1/s1 |
| InChIKey | BEGSWONQWMQZGV-OAQYLSRUSA-N |
| XLogP | 6.65 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|