C30H33ClN4O4S — CID 126094830
(6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126094830) has the molecular formula C30H33ClN4O4S and a molecular weight of 581.14 g/mol. Its IUPAC name is (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126094830 |
| Molecular Formula | C30H33ClN4O4S |
| Molecular Weight | 581.14 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[(4-morpholin-4-yl-3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3ccc(N4CCOCC4)c([N+](=O)[O-])c3)c2C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C30H33ClN4O4S/c1-30(2,3)20-5-10-23-26(17-20)40-29(27(23)28(36)33-22-8-6-21(31)7-9-22)32-18-19-4-11-24(25(16-19)35(37)38)34-12-14-39-15-13-34/h4,6-9,11,16,18,20H,5,10,12-15,17H2,1-3H3,(H,33,36)/t20-/m0/s1 |
| InChIKey | JTZDCEGWVPYYIJ-FQEVSTJZSA-N |
| XLogP | 7.30 |
| TPSA | 97.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.14 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|