C34H34ClN3O5S — CID 126090683
(6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126090683) has the molecular formula C34H34ClN3O5S and a molecular weight of 632.18 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126090683 |
| Molecular Formula | C34H34ClN3O5S |
| Molecular Weight | 632.18 g/mol |
| Exact Mass | 631.19 |
| IUPAC Name | (6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[[3-methoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COc1cc(C=Nc2sc3c(c2C(=O)Nc2ccc(Cl)cc2)CC[C@@H](C(C)(C)C)C3)ccc1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H34ClN3O5S/c1-34(2,3)23-8-15-27-30(18-23)44-33(31(27)32(39)37-25-11-9-24(35)10-12-25)36-19-22-7-16-28(29(17-22)42-4)43-20-21-5-13-26(14-6-21)38(40)41/h5-7,9-14,16-17,19,23H,8,15,18,20H2,1-4H3,(H,37,39)/t23-/m1/s1 |
| InChIKey | VEIKFRRAOPMOGG-HSZRJFAPSA-N |
| XLogP | 9.05 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.18 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|