C33H32ClN3O4S — CID 126085982
(6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126085982) has the molecular formula C33H32ClN3O4S and a molecular weight of 602.16 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126085982 |
| Molecular Formula | C33H32ClN3O4S |
| Molecular Weight | 602.16 g/mol |
| Exact Mass | 601.18 |
| IUPAC Name | (6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[[2-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(N=Cc3ccccc3OCc3ccc([N+](=O)[O-])cc3)c2C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C33H32ClN3O4S/c1-33(2,3)23-10-17-27-29(18-23)42-32(30(27)31(38)36-25-13-11-24(34)12-14-25)35-19-22-6-4-5-7-28(22)41-20-21-8-15-26(16-9-21)37(39)40/h4-9,11-16,19,23H,10,17-18,20H2,1-3H3,(H,36,38)/t23-/m1/s1 |
| InChIKey | LILOZODPDLVIST-HSZRJFAPSA-N |
| XLogP | 9.04 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.16 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|