C32H33ClN4O3S — CID 126087755
(6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126087755) has the molecular formula C32H33ClN4O3S and a molecular weight of 589.16 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126087755 |
| Molecular Formula | C32H33ClN4O3S |
| Molecular Weight | 589.16 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | (6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[[2,5-dimethyl-1-(4-nitrophenyl)pyrrol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cc(C=Nc2sc3c(c2C(=O)Nc2ccc(Cl)cc2)CC[C@@H](C(C)(C)C)C3)c(C)n1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H33ClN4O3S/c1-19-16-21(20(2)36(19)25-11-13-26(14-12-25)37(39)40)18-34-31-29(30(38)35-24-9-7-23(33)8-10-24)27-15-6-22(32(3,4)5)17-28(27)41-31/h7-14,16,18,22H,6,15,17H2,1-5H3,(H,35,38)/t22-/m1/s1 |
| InChIKey | PVYRPRZLJFUESG-JOCHJYFZSA-N |
| XLogP | 8.87 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.16 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|