C31H30ClN5O4S2 — CID 137043338
(6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 137043338) has the molecular formula C31H30ClN5O4S2 and a molecular weight of 636.20 g/mol. Its IUPAC name is (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 137043338 |
| Molecular Formula | C31H30ClN5O4S2 |
| Molecular Weight | 636.20 g/mol |
| Exact Mass | 635.14 |
| IUPAC Name | (6S)-6-tert-butyl-N-(4-chlorophenyl)-2-[[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cc(=O)[nH]c(Sc2ccc([N+](=O)[O-])cc2C=Nc2sc3c(c2C(=O)Nc2ccc(Cl)cc2)CC[C@H](C(C)(C)C)C3)n1 |
| InChI | InChI=1S/C31H30ClN5O4S2/c1-17-13-26(38)36-30(34-17)43-24-12-10-22(37(40)41)14-18(24)16-33-29-27(28(39)35-21-8-6-20(32)7-9-21)23-11-5-19(31(2,3)4)15-25(23)42-29/h6-10,12-14,16,19H,5,11,15H2,1-4H3,(H,35,39)(H,34,36,38)/t19-/m0/s1 |
| InChIKey | MCWLHYPVHPQLFH-IBGZPJMESA-N |
| XLogP | 8.01 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.20 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|