C30H27Cl2N3O4S — CID 126090022
(6S)-6-tert-butyl-2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-N-(4-chlorophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126090022) has the molecular formula C30H27Cl2N3O4S and a molecular weight of 596.54 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-N-(4-chlorophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-N-(4-chlorophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126090022 |
| Molecular Formula | C30H27Cl2N3O4S |
| Molecular Weight | 596.54 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | (6S)-6-tert-butyl-2-[[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]-N-(4-chlorophenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3ccc(-c4ccc([N+](=O)[O-])cc4Cl)o3)c2C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C30H27Cl2N3O4S/c1-30(2,3)17-4-11-23-26(14-17)40-29(27(23)28(36)34-19-7-5-18(31)6-8-19)33-16-21-10-13-25(39-21)22-12-9-20(35(37)38)15-24(22)32/h5-10,12-13,15-17H,4,11,14H2,1-3H3,(H,34,36)/t17-/m0/s1 |
| InChIKey | VXRVEVAUOAXWAR-KRWDZBQOSA-N |
| XLogP | 9.38 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.54 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|