C32H30ClN3O3S2 — CID 126125767
(6S)-6-tert-butyl-2-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126125767) has the molecular formula C32H30ClN3O3S2 and a molecular weight of 604.20 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-2-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126125767 |
| Molecular Formula | C32H30ClN3O3S2 |
| Molecular Weight | 604.20 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | (6S)-6-tert-butyl-2-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3ccc(Sc4ccc(Cl)cc4)c([N+](=O)[O-])c3)c2C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C32H30ClN3O3S2/c1-32(2,3)21-10-15-25-28(18-21)41-31(29(25)30(37)35-23-7-5-4-6-8-23)34-19-20-9-16-27(26(17-20)36(38)39)40-24-13-11-22(33)12-14-24/h4-9,11-14,16-17,19,21H,10,15,18H2,1-3H3,(H,35,37)/t21-/m0/s1 |
| InChIKey | WSEQNKNGKPDPMT-NRFANRHFSA-N |
| XLogP | 9.61 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.20 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|