C26H26ClIN2OS — CID 126095028
(6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[(3-iodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126095028) has the molecular formula C26H26ClIN2OS and a molecular weight of 576.93 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[(3-iodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[(3-iodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126095028 |
| Molecular Formula | C26H26ClIN2OS |
| Molecular Weight | 576.93 g/mol |
| Exact Mass | 576.05 |
| IUPAC Name | (6R)-6-tert-butyl-N-(4-chlorophenyl)-2-[(3-iodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(N=Cc3cccc(I)c3)c2C(=O)Nc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C26H26ClIN2OS/c1-26(2,3)17-7-12-21-22(14-17)32-25(29-15-16-5-4-6-19(28)13-16)23(21)24(31)30-20-10-8-18(27)9-11-20/h4-6,8-11,13,15,17H,7,12,14H2,1-3H3,(H,30,31)/t17-/m1/s1 |
| InChIKey | GJFPRYUVUJWBAO-QGZVFWFLSA-N |
| XLogP | 8.16 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.93 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|