C26H26BrN3O3S — CID 98167379
(6S)-N-(4-bromophenyl)-6-tert-butyl-2-[(3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 98167379) has the molecular formula C26H26BrN3O3S and a molecular weight of 540.48 g/mol. Its IUPAC name is (6S)-N-(4-bromophenyl)-6-tert-butyl-2-[(3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-N-(4-bromophenyl)-6-tert-butyl-2-[(3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 98167379 |
| Molecular Formula | C26H26BrN3O3S |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | (6S)-N-(4-bromophenyl)-6-tert-butyl-2-[(3-nitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3cccc([N+](=O)[O-])c3)c2C(=O)Nc2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C26H26BrN3O3S/c1-26(2,3)17-7-12-21-22(14-17)34-25(28-15-16-5-4-6-20(13-16)30(32)33)23(21)24(31)29-19-10-8-18(27)9-11-19/h4-6,8-11,13,15,17H,7,12,14H2,1-3H3,(H,29,31)/t17-/m0/s1 |
| InChIKey | KDWUEILZCWOQGW-KRWDZBQOSA-N |
| XLogP | 7.57 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|