C26H24ClN3O2S2 — CID 126128289
(6S)-6-tert-butyl-2-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 126128289) has the molecular formula C26H24ClN3O2S2 and a molecular weight of 510.08 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6S)-6-tert-butyl-2-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 126128289 |
| Molecular Formula | C26H24ClN3O2S2 |
| Molecular Weight | 510.08 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | (6S)-6-tert-butyl-2-[[4-(4-chlorophenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3ccc(Sc4ccc(Cl)cc4)c([N+](=O)[O-])c3)c2C#N)C1 |
| InChI | InChI=1S/C26H24ClN3O2S2/c1-26(2,3)17-5-10-20-21(14-28)25(34-24(20)13-17)29-15-16-4-11-23(22(12-16)30(31)32)33-19-8-6-18(27)7-9-19/h4,6-9,11-12,15,17H,5,10,13H2,1-3H3/t17-/m0/s1 |
| InChIKey | WHOIJICPJRRSOQ-KRWDZBQOSA-N |
| XLogP | 8.23 |
| TPSA | 79.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.08 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|