C28H24Cl2N6O2S2 — CID 126202721
(6R)-6-tert-butyl-2-[[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 126202721) has the molecular formula C28H24Cl2N6O2S2 and a molecular weight of 611.58 g/mol. Its IUPAC name is (6R)-6-tert-butyl-2-[[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6R)-6-tert-butyl-2-[[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 126202721 |
| Molecular Formula | C28H24Cl2N6O2S2 |
| Molecular Weight | 611.58 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | (6R)-6-tert-butyl-2-[[4-[[5-(2,4-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(N=Cc3ccc(Sc4n[nH]c(-c5ccc(Cl)cc5Cl)n4)c([N+](=O)[O-])c3)c2C#N)C1 |
| InChI | InChI=1S/C28H24Cl2N6O2S2/c1-28(2,3)16-5-7-18-20(13-31)26(39-24(18)11-16)32-14-15-4-9-23(22(10-15)36(37)38)40-27-33-25(34-35-27)19-8-6-17(29)12-21(19)30/h4,6,8-10,12,14,16H,5,7,11H2,1-3H3,(H,33,34,35)/t16-/m1/s1 |
| InChIKey | ZRGJZZLOEJBGAI-MRXNPFEDSA-N |
| XLogP | 8.67 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.58 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|