C20H20N4O5S — CID 137085787
(6S)-6-tert-butyl-2-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 137085787) has the molecular formula C20H20N4O5S and a molecular weight of 428.47 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6S)-6-tert-butyl-2-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 137085787 |
| Molecular Formula | C20H20N4O5S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (6S)-6-tert-butyl-2-[(2-hydroxy-3,5-dinitrophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3O)c2C#N)C1 |
| InChI | InChI=1S/C20H20N4O5S/c1-20(2,3)12-4-5-14-15(9-21)19(30-17(14)7-12)22-10-11-6-13(23(26)27)8-16(18(11)25)24(28)29/h6,8,10,12,25H,4-5,7H2,1-3H3/t12-/m0/s1 |
| InChIKey | KDMZDQDAPAYNLO-LBPRGKRZSA-N |
| XLogP | 5.04 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|