C25H25N3O3S — CID 126086910
(6S)-6-tert-butyl-2-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 126086910) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6S)-6-tert-butyl-2-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 126086910 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | (6S)-6-tert-butyl-2-[[5-(2-methyl-3-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | Cc1c(-c2ccc(C=Nc3sc4c(c3C#N)CC[C@H](C(C)(C)C)C4)o2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H25N3O3S/c1-15-18(6-5-7-21(15)28(29)30)22-11-9-17(31-22)14-27-24-20(13-26)19-10-8-16(25(2,3)4)12-23(19)32-24/h5-7,9,11,14,16H,8,10,12H2,1-4H3/t16-/m0/s1 |
| InChIKey | LOTUWHBFVRXHTM-INIZCTEOSA-N |
| XLogP | 7.00 |
| TPSA | 92.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|