C24H24N4O2S — CID 126090887
(6S)-6-tert-butyl-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 126090887) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6S)-6-tert-butyl-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 126090887 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (6S)-6-tert-butyl-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3cccn3-c3ccc([N+](=O)[O-])cc3)c2C#N)C1 |
| InChI | InChI=1S/C24H24N4O2S/c1-24(2,3)16-6-11-20-21(14-25)23(31-22(20)13-16)26-15-19-5-4-12-27(19)17-7-9-18(10-8-17)28(29)30/h4-5,7-10,12,15-16H,6,11,13H2,1-3H3/t16-/m0/s1 |
| InChIKey | MGGRXIDZBMSUFE-INIZCTEOSA-N |
| XLogP | 6.22 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|