C29H30BrN3O4S — CID 126210639
(6S)-2-[[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 126210639) has the molecular formula C29H30BrN3O4S and a molecular weight of 596.55 g/mol. Its IUPAC name is (6S)-2-[[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6S)-2-[[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 126210639 |
| Molecular Formula | C29H30BrN3O4S |
| Molecular Weight | 596.55 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | (6S)-2-[[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CCOc1cc(C=Nc2sc3c(c2C#N)CC[C@H](C(C)(C)C)C3)cc(Br)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H30BrN3O4S/c1-5-36-25-13-19(12-24(30)27(25)37-17-18-6-9-21(10-7-18)33(34)35)16-32-28-23(15-31)22-11-8-20(29(2,3)4)14-26(22)38-28/h6-7,9-10,12-13,16,20H,5,8,11,14,17H2,1-4H3/t20-/m0/s1 |
| InChIKey | GLTNLHXEIZZXSO-FQEVSTJZSA-N |
| XLogP | 8.17 |
| TPSA | 97.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.55 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|