C27H28N4O4S — CID 126213938
(6R)-6-tert-butyl-2-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 126213938) has the molecular formula C27H28N4O4S and a molecular weight of 504.61 g/mol. Its IUPAC name is (6R)-6-tert-butyl-2-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6R)-6-tert-butyl-2-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 126213938 |
| Molecular Formula | C27H28N4O4S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | (6R)-6-tert-butyl-2-[[3-ethoxy-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CCOc1cc(C=Nc2sc3c(c2C#N)CC[C@@H](C(C)(C)C)C3)ccc1Oc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C27H28N4O4S/c1-5-34-23-12-17(6-10-22(23)35-25-11-8-19(16-29-25)31(32)33)15-30-26-21(14-28)20-9-7-18(27(2,3)4)13-24(20)36-26/h6,8,10-12,15-16,18H,5,7,9,13H2,1-4H3/t18-/m1/s1 |
| InChIKey | YGFBNPLKCJCPKX-GOSISDBHSA-N |
| XLogP | 7.02 |
| TPSA | 110.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|