C29H30N4O4S — CID 126093949
(6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126093949) has the molecular formula C29H30N4O4S and a molecular weight of 530.65 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126093949 |
| Molecular Formula | C29H30N4O4S |
| Molecular Weight | 530.65 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(N=Cc3cccn3-c3ccc([N+](=O)[O-])cc3)c2C(=O)NCc2ccco2)C1 |
| InChI | InChI=1S/C29H30N4O4S/c1-29(2,3)19-8-13-24-25(16-19)38-28(26(24)27(34)30-18-23-7-5-15-37-23)31-17-22-6-4-14-32(22)20-9-11-21(12-10-20)33(35)36/h4-7,9-12,14-15,17,19H,8,13,16,18H2,1-3H3,(H,30,34)/t19-/m1/s1 |
| InChIKey | CDMYFILKFJPZTR-LJQANCHMSA-N |
| XLogP | 6.87 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.65 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|