C25H26BrN3O5S — CID 137085623
(6S)-2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-6-tert-butyl-N-(furan-2-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 137085623) has the molecular formula C25H26BrN3O5S and a molecular weight of 560.47 g/mol. Its IUPAC name is (6S)-2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-6-tert-butyl-N-(furan-2-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-6-tert-butyl-N-(furan-2-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 137085623 |
| Molecular Formula | C25H26BrN3O5S |
| Molecular Weight | 560.47 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | (6S)-2-[(5-bromo-2-hydroxy-3-nitrophenyl)methylideneamino]-6-tert-butyl-N-(furan-2-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3cc(Br)cc([N+](=O)[O-])c3O)c2C(=O)NCc2ccco2)C1 |
| InChI | InChI=1S/C25H26BrN3O5S/c1-25(2,3)15-6-7-18-20(10-15)35-24(21(18)23(31)27-13-17-5-4-8-34-17)28-12-14-9-16(26)11-19(22(14)30)29(32)33/h4-5,8-9,11-12,15,30H,6-7,10,13H2,1-3H3,(H,27,31)/t15-/m0/s1 |
| InChIKey | YJAOLMFLVNLGJJ-HNNXBMFYSA-N |
| XLogP | 6.55 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.47 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|