C32H33N3O4S2 — CID 126083630
(6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126083630) has the molecular formula C32H33N3O4S2 and a molecular weight of 587.77 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126083630 |
| Molecular Formula | C32H33N3O4S2 |
| Molecular Weight | 587.77 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(Sc2ccc(C=Nc3sc4c(c3C(=O)NCc3ccco3)CC[C@@H](C(C)(C)C)C4)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H33N3O4S2/c1-20-7-11-24(12-8-20)40-27-14-9-21(16-26(27)35(37)38)18-34-31-29(30(36)33-19-23-6-5-15-39-23)25-13-10-22(32(2,3)4)17-28(25)41-31/h5-9,11-12,14-16,18,22H,10,13,17,19H2,1-4H3,(H,33,36)/t22-/m1/s1 |
| InChIKey | DQURZZGITBLTFL-JOCHJYFZSA-N |
| XLogP | 8.54 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.77 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|