C27H30N2O4S — CID 126093005
(6S)-6-tert-butyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-N-(furan-2-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126093005) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-N-(furan-2-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-N-(furan-2-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126093005 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (6S)-6-tert-butyl-2-(2,3-dihydro-1,4-benzodioxin-6-ylmethylideneamino)-N-(furan-2-ylmethyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3ccc4c(c3)OCCO4)c2C(=O)NCc2ccco2)C1 |
| InChI | InChI=1S/C27H30N2O4S/c1-27(2,3)18-7-8-20-23(14-18)34-26(24(20)25(30)28-16-19-5-4-10-31-19)29-15-17-6-9-21-22(13-17)33-12-11-32-21/h4-6,9-10,13,15,18H,7-8,11-12,14,16H2,1-3H3,(H,28,30)/t18-/m0/s1 |
| InChIKey | AFHLPIATSWPIRF-SFHVURJKSA-N |
| XLogP | 5.94 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|