C28H34N2O5S — CID 126084884
(6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(3,4,5-trimethoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126084884) has the molecular formula C28H34N2O5S and a molecular weight of 510.66 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(3,4,5-trimethoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(3,4,5-trimethoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126084884 |
| Molecular Formula | C28H34N2O5S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(3,4,5-trimethoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COc1cc(C=Nc2sc3c(c2C(=O)NCc2ccco2)CC[C@@H](C(C)(C)C)C3)cc(OC)c1OC |
| InChI | InChI=1S/C28H34N2O5S/c1-28(2,3)18-9-10-20-23(14-18)36-27(24(20)26(31)29-16-19-8-7-11-35-19)30-15-17-12-21(32-4)25(34-6)22(13-17)33-5/h7-8,11-13,15,18H,9-10,14,16H2,1-6H3,(H,29,31)/t18-/m1/s1 |
| InChIKey | IMUXGMVYMWJNBJ-GOSISDBHSA-N |
| XLogP | 6.20 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|