C28H32N2O3S — CID 126094164
(6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(4-prop-2-enoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126094164) has the molecular formula C28H32N2O3S and a molecular weight of 476.64 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(4-prop-2-enoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(4-prop-2-enoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126094164 |
| Molecular Formula | C28H32N2O3S |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(4-prop-2-enoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C=CCOc1ccc(C=Nc2sc3c(c2C(=O)NCc2ccco2)CC[C@@H](C(C)(C)C)C3)cc1 |
| InChI | InChI=1S/C28H32N2O3S/c1-5-14-32-21-11-8-19(9-12-21)17-30-27-25(26(31)29-18-22-7-6-15-33-22)23-13-10-20(28(2,3)4)16-24(23)34-27/h5-9,11-12,15,17,20H,1,10,13-14,16,18H2,2-4H3,(H,29,31)/t20-/m1/s1 |
| InChIKey | ZSEKIENWRGYFHH-HXUWFJFHSA-N |
| XLogP | 6.74 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|