C32H33N3O5S — CID 126083074
(6S)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126083074) has the molecular formula C32H33N3O5S and a molecular weight of 571.70 g/mol. Its IUPAC name is (6S)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126083074 |
| Molecular Formula | C32H33N3O5S |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | (6S)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3ccc(OCc4ccc([N+](=O)[O-])cc4)cc3)c2C(=O)NCc2ccco2)C1 |
| InChI | InChI=1S/C32H33N3O5S/c1-32(2,3)23-10-15-27-28(17-23)41-31(29(27)30(36)33-19-26-5-4-16-39-26)34-18-21-8-13-25(14-9-21)40-20-22-6-11-24(12-7-22)35(37)38/h4-9,11-14,16,18,23H,10,15,17,19-20H2,1-3H3,(H,33,36)/t23-/m0/s1 |
| InChIKey | BYJMCGXRUYWERT-QHCPKHFHSA-N |
| XLogP | 7.66 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|