C30H31N3O5S — CID 126091487
(6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126091487) has the molecular formula C30H31N3O5S and a molecular weight of 545.66 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126091487 |
| Molecular Formula | C30H31N3O5S |
| Molecular Weight | 545.66 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[5-(4-methyl-2-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C=Nc3sc4c(c3C(=O)NCc3ccco3)CC[C@@H](C(C)(C)C)C4)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H31N3O5S/c1-18-7-10-22(24(14-18)33(35)36)25-12-9-21(38-25)17-32-29-27(28(34)31-16-20-6-5-13-37-20)23-11-8-19(30(2,3)4)15-26(23)39-29/h5-7,9-10,12-14,17,19H,8,11,15-16H2,1-4H3,(H,31,34)/t19-/m1/s1 |
| InChIKey | YSEZJZFLLBTDRU-LJQANCHMSA-N |
| XLogP | 7.65 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.66 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|