C29H34N4O4S — CID 126094314
(6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126094314) has the molecular formula C29H34N4O4S and a molecular weight of 534.68 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126094314 |
| Molecular Formula | C29H34N4O4S |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(5-nitro-2-pyrrolidin-1-ylphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(N=Cc3cc([N+](=O)[O-])ccc3N3CCCC3)c2C(=O)NCc2ccco2)C1 |
| InChI | InChI=1S/C29H34N4O4S/c1-29(2,3)20-8-10-23-25(16-20)38-28(26(23)27(34)30-18-22-7-6-14-37-22)31-17-19-15-21(33(35)36)9-11-24(19)32-12-4-5-13-32/h6-7,9,11,14-15,17,20H,4-5,8,10,12-13,16,18H2,1-3H3,(H,30,34)/t20-/m1/s1 |
| InChIKey | DDZQWWWARGKKEM-HXUWFJFHSA-N |
| XLogP | 6.68 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|