C35H36N4O4S — CID 126089563
(6S)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126089563) has the molecular formula C35H36N4O4S and a molecular weight of 608.76 g/mol. Its IUPAC name is (6S)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126089563 |
| Molecular Formula | C35H36N4O4S |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | (6S)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1c(C=Nc2sc3c(c2C(=O)NCc2ccco2)CC[C@H](C(C)(C)C)C3)c2ccccc2n1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C35H36N4O4S/c1-22-29(27-9-5-6-10-30(27)38(22)21-23-11-14-25(15-12-23)39(41)42)20-37-34-32(33(40)36-19-26-8-7-17-43-26)28-16-13-24(35(2,3)4)18-31(28)44-34/h5-12,14-15,17,20,24H,13,16,18-19,21H2,1-4H3,(H,36,40)/t24-/m0/s1 |
| InChIKey | NSXYYYCQDKCIEQ-DEOSSOPVSA-N |
| XLogP | 8.39 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|