C30H33N3O2S — CID 126084098
(6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(1-prop-2-enylindol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126084098) has the molecular formula C30H33N3O2S and a molecular weight of 499.68 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(1-prop-2-enylindol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(1-prop-2-enylindol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126084098 |
| Molecular Formula | C30H33N3O2S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | (6R)-6-tert-butyl-N-(furan-2-ylmethyl)-2-[(1-prop-2-enylindol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C=CCn1cc(C=Nc2sc3c(c2C(=O)NCc2ccco2)CC[C@@H](C(C)(C)C)C3)c2ccccc21 |
| InChI | InChI=1S/C30H33N3O2S/c1-5-14-33-19-20(23-10-6-7-11-25(23)33)17-32-29-27(28(34)31-18-22-9-8-15-35-22)24-13-12-21(30(2,3)4)16-26(24)36-29/h5-11,15,17,19,21H,1,12-14,16,18H2,2-4H3,(H,31,34)/t21-/m1/s1 |
| InChIKey | FZFVGEVCRHRJBG-OAQYLSRUSA-N |
| XLogP | 7.31 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|