C36H36N4O3S — CID 126085053
(6R)-6-tert-butyl-2-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126085053) has the molecular formula C36H36N4O3S and a molecular weight of 604.78 g/mol. Its IUPAC name is (6R)-6-tert-butyl-2-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-2-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126085053 |
| Molecular Formula | C36H36N4O3S |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | (6R)-6-tert-butyl-2-[[2-methyl-1-[(4-nitrophenyl)methyl]indol-3-yl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1c(C=Nc2sc3c(c2C(=O)Nc2ccccc2)CC[C@@H](C(C)(C)C)C3)c2ccccc2n1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C36H36N4O3S/c1-23-30(28-12-8-9-13-31(28)39(23)22-24-14-17-27(18-15-24)40(42)43)21-37-35-33(34(41)38-26-10-6-5-7-11-26)29-19-16-25(36(2,3)4)20-32(29)44-35/h5-15,17-18,21,25H,16,19-20,22H2,1-4H3,(H,38,41)/t25-/m1/s1 |
| InChIKey | IZFUABDCOHHIMO-RUZDIDTESA-N |
| XLogP | 9.12 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|