C30H35N3O3S — CID 136882415
(6S)-2-[[5-(1-adamantyl)-2-hydroxy-3-nitrophenyl]methylideneamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 136882415) has the molecular formula C30H35N3O3S and a molecular weight of 517.70 g/mol. Its IUPAC name is (6S)-2-[[5-(1-adamantyl)-2-hydroxy-3-nitrophenyl]methylideneamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | (6S)-2-[[5-(1-adamantyl)-2-hydroxy-3-nitrophenyl]methylideneamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 136882415 |
| Molecular Formula | C30H35N3O3S |
| Molecular Weight | 517.70 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | (6S)-2-[[5-(1-adamantyl)-2-hydroxy-3-nitrophenyl]methylideneamino]-6-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CC(C)(C)[C@H]1CCc2c(sc(N=Cc3cc(C45CC6CC(CC(C6)C4)C5)cc([N+](=O)[O-])c3O)c2C#N)C1 |
| InChI | InChI=1S/C30H35N3O3S/c1-29(2,3)21-4-5-23-24(15-31)28(37-26(23)11-21)32-16-20-9-22(10-25(27(20)34)33(35)36)30-12-17-6-18(13-30)8-19(7-17)14-30/h9-10,16-19,21,34H,4-8,11-14H2,1-3H3/t17?,18?,19?,21-,30?/m0/s1 |
| InChIKey | FHZFDFZNORRISP-XGMLTQACSA-N |
| XLogP | 7.60 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.70 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|